Benzene and substituted derivatives
Filtered Search Results
4-Chloro-3-nitrobenzaldehyde, 97%
CAS: 16588-34-4 Molecular Formula: C7H4ClNO3 Molecular Weight (g/mol): 185.56 MDL Number: MFCD00007078 InChI Key: HETBKLHJEWXWBM-UHFFFAOYSA-N Synonym: 3-nitro-4-chlorobenzaldehyde,benzaldehyde, 4-chloro-3-nitro,chembl51664,4-chloro-3-nitro-benzaldehyde,pubchem14274,acmc-1c7bn,3nitro-4-chlorobenzaldehyde,asischem r36965,dsstox_cid_24846,dsstox_rid_80526 PubChem CID: 85505 IUPAC Name: 4-chloro-3-nitrobenzaldehyde SMILES: [O-][N+](=O)C1=CC(C=O)=CC=C1Cl
| PubChem CID | 85505 |
|---|---|
| CAS | 16588-34-4 |
| Molecular Weight (g/mol) | 185.56 |
| MDL Number | MFCD00007078 |
| SMILES | [O-][N+](=O)C1=CC(C=O)=CC=C1Cl |
| Synonym | 3-nitro-4-chlorobenzaldehyde,benzaldehyde, 4-chloro-3-nitro,chembl51664,4-chloro-3-nitro-benzaldehyde,pubchem14274,acmc-1c7bn,3nitro-4-chlorobenzaldehyde,asischem r36965,dsstox_cid_24846,dsstox_rid_80526 |
| IUPAC Name | 4-chloro-3-nitrobenzaldehyde |
| InChI Key | HETBKLHJEWXWBM-UHFFFAOYSA-N |
| Molecular Formula | C7H4ClNO3 |
3-Acetamidobenzoic acid, 98%
CAS: 587-48-4 Molecular Formula: C9H9NO3 Molecular Weight (g/mol): 179.175 MDL Number: MFCD00013983 InChI Key: RGDPZMQZWZMONQ-UHFFFAOYSA-N Synonym: 3-acetylamino benzoic acid,benzoic acid, 3-acetylamino,3-acetylaminobenzoic acid,m-acetylaminobenzoic acid,benzoic acid, m-acetamido,n-acetyl-m-aminobenzoic acid,3-acetylamino-benzoic acid,3-acetylamino-benzoicaci,3-acetamidobenzoicacid,3'-carboxyacetanilide PubChem CID: 48847 IUPAC Name: 3-acetamidobenzoic acid SMILES: CC(=O)NC1=CC=CC(=C1)C(=O)O
| PubChem CID | 48847 |
|---|---|
| CAS | 587-48-4 |
| Molecular Weight (g/mol) | 179.175 |
| MDL Number | MFCD00013983 |
| SMILES | CC(=O)NC1=CC=CC(=C1)C(=O)O |
| Synonym | 3-acetylamino benzoic acid,benzoic acid, 3-acetylamino,3-acetylaminobenzoic acid,m-acetylaminobenzoic acid,benzoic acid, m-acetamido,n-acetyl-m-aminobenzoic acid,3-acetylamino-benzoic acid,3-acetylamino-benzoicaci,3-acetamidobenzoicacid,3'-carboxyacetanilide |
| IUPAC Name | 3-acetamidobenzoic acid |
| InChI Key | RGDPZMQZWZMONQ-UHFFFAOYSA-N |
| Molecular Formula | C9H9NO3 |
4-Fluoro-3-nitroanisole, 95%
CAS: 61324-93-4 Molecular Formula: C7H6FNO3 Molecular Weight (g/mol): 171.127 MDL Number: MFCD11848442 InChI Key: ZRIKJXDEJYMBEJ-UHFFFAOYSA-N Synonym: 4-fluoro-3-nitroanisole,benzene, 1-fluoro-4-methoxy-2-nitro,3-fluoro-4-nitrobenzene,-1-methoxy,ksc613a5f,2-fluoro-5-methoxynitrobenzene,2-fluoro-5-methoxy-nitrobenzene,# PubChem CID: 565653 IUPAC Name: 1-fluoro-4-methoxy-2-nitrobenzene SMILES: COC1=CC(=C(C=C1)F)[N+](=O)[O-]
| PubChem CID | 565653 |
|---|---|
| CAS | 61324-93-4 |
| Molecular Weight (g/mol) | 171.127 |
| MDL Number | MFCD11848442 |
| SMILES | COC1=CC(=C(C=C1)F)[N+](=O)[O-] |
| Synonym | 4-fluoro-3-nitroanisole,benzene, 1-fluoro-4-methoxy-2-nitro,3-fluoro-4-nitrobenzene,-1-methoxy,ksc613a5f,2-fluoro-5-methoxynitrobenzene,2-fluoro-5-methoxy-nitrobenzene,# |
| IUPAC Name | 1-fluoro-4-methoxy-2-nitrobenzene |
| InChI Key | ZRIKJXDEJYMBEJ-UHFFFAOYSA-N |
| Molecular Formula | C7H6FNO3 |
4-Isopropylbenzenesulfonyl chloride, 96%
CAS: 54997-90-9 Molecular Formula: C9H11ClO2S Molecular Weight (g/mol): 218.70 MDL Number: MFCD00041510 InChI Key: CETRNHJIXGITKR-UHFFFAOYSA-N Synonym: 4-isopropylbenzenesulfonyl chloride,4-isopropylbenzene-1-sulfonyl chloride,4-isopropylbenzenesulfonylchloride,4-propan-2-yl benzene-1-sulfonyl chloride,4-isopropyl benzenesulfonyl chloride,4-isopropyl-benzenesulfonyl chloride,4-propan-2-yl benzenesulfonyl chloride,4-isopropylbenzensulfonylchloride,4-isopropylphenylsulfonyl chloride,p-isopropylbenzenesulfonyl chloride PubChem CID: 2734882 IUPAC Name: 4-propan-2-ylbenzenesulfonyl chloride SMILES: CC(C)C1=CC=C(C=C1)S(Cl)(=O)=O
| PubChem CID | 2734882 |
|---|---|
| CAS | 54997-90-9 |
| Molecular Weight (g/mol) | 218.70 |
| MDL Number | MFCD00041510 |
| SMILES | CC(C)C1=CC=C(C=C1)S(Cl)(=O)=O |
| Synonym | 4-isopropylbenzenesulfonyl chloride,4-isopropylbenzene-1-sulfonyl chloride,4-isopropylbenzenesulfonylchloride,4-propan-2-yl benzene-1-sulfonyl chloride,4-isopropyl benzenesulfonyl chloride,4-isopropyl-benzenesulfonyl chloride,4-propan-2-yl benzenesulfonyl chloride,4-isopropylbenzensulfonylchloride,4-isopropylphenylsulfonyl chloride,p-isopropylbenzenesulfonyl chloride |
| IUPAC Name | 4-propan-2-ylbenzenesulfonyl chloride |
| InChI Key | CETRNHJIXGITKR-UHFFFAOYSA-N |
| Molecular Formula | C9H11ClO2S |
Bis(2-ethylhexyl) terephthalate, 97%
CAS: 6422-86-2 Molecular Formula: C24H38O4 Molecular Weight (g/mol): 390.55 MDL Number: MFCD00072256 InChI Key: RWPICVVBGZBXNA-UHFFFAOYSA-N Synonym: bis 2-ethylhexyl terephthalate,kodaflex dotp,di-2-ethylhexyl terephthalate,1,4-benzenedicarboxylic acid, bis 2-ethylhexyl ester,terephthalic acid, bis 2-ethylhexyl ester,eastman 168,ccris 7052,di 2-ethylhexyl terephthalate,bis 2-ethylhexyl benzene-1,4-dicarboxylate,1,4-benzenedicarboxylic acid, 1,4-bis 2-ethylhexyl ester PubChem CID: 22932 IUPAC Name: bis(2-ethylhexyl) benzene-1,4-dicarboxylate SMILES: CCCCC(CC)COC(=O)C1=CC=C(C=C1)C(=O)OCC(CC)CCCC
| PubChem CID | 22932 |
|---|---|
| CAS | 6422-86-2 |
| Molecular Weight (g/mol) | 390.55 |
| MDL Number | MFCD00072256 |
| SMILES | CCCCC(CC)COC(=O)C1=CC=C(C=C1)C(=O)OCC(CC)CCCC |
| Synonym | bis 2-ethylhexyl terephthalate,kodaflex dotp,di-2-ethylhexyl terephthalate,1,4-benzenedicarboxylic acid, bis 2-ethylhexyl ester,terephthalic acid, bis 2-ethylhexyl ester,eastman 168,ccris 7052,di 2-ethylhexyl terephthalate,bis 2-ethylhexyl benzene-1,4-dicarboxylate,1,4-benzenedicarboxylic acid, 1,4-bis 2-ethylhexyl ester |
| IUPAC Name | bis(2-ethylhexyl) benzene-1,4-dicarboxylate |
| InChI Key | RWPICVVBGZBXNA-UHFFFAOYSA-N |
| Molecular Formula | C24H38O4 |
2-Methyl-3-phenyl-1-propene, 99%
CAS: 3290-53-7 Molecular Formula: C10H12 Molecular Weight (g/mol): 132.206 MDL Number: MFCD00039815 InChI Key: MXTNFIYGTWARIN-UHFFFAOYSA-N Synonym: 2-methyl-3-phenyl-1-propene,methallylbenzene,benzene, 2-methyl-2-propenyl,benzene, 2-methylallyl,2-methylprop-2-en-1-yl benzene,2-methyl-2-propenyl benzene,methallyl benzene,2-methylallylbenzene,2-benzyl-1-propene,2-methylallyl benzene PubChem CID: 18687 IUPAC Name: 2-methylprop-2-enylbenzene SMILES: CC(=C)CC1=CC=CC=C1
| PubChem CID | 18687 |
|---|---|
| CAS | 3290-53-7 |
| Molecular Weight (g/mol) | 132.206 |
| MDL Number | MFCD00039815 |
| SMILES | CC(=C)CC1=CC=CC=C1 |
| Synonym | 2-methyl-3-phenyl-1-propene,methallylbenzene,benzene, 2-methyl-2-propenyl,benzene, 2-methylallyl,2-methylprop-2-en-1-yl benzene,2-methyl-2-propenyl benzene,methallyl benzene,2-methylallylbenzene,2-benzyl-1-propene,2-methylallyl benzene |
| IUPAC Name | 2-methylprop-2-enylbenzene |
| InChI Key | MXTNFIYGTWARIN-UHFFFAOYSA-N |
| Molecular Formula | C10H12 |
Methyl 4-tert-butylbenzoate, 99%, Thermo Scientific™
CAS: 26537-19-9 Molecular Formula: C12H16O2 Molecular Weight (g/mol): 192.26 MDL Number: MFCD00008835 InChI Key: UPIJOAFHOIWPLT-UHFFFAOYSA-N Synonym: methyl 4-tert-butyl benzoate,methyl p-tert-butylbenzoate,4-tert-butylbenzoic acid methyl ester,unii-8vk4o27jmt,benzoic acid, 4-1,1-dimethylethyl-, methyl ester,methyl 4-t-butylbenzoate,8vk4o27jmt,methyl4-tert-butylbenzoate,methyl p-t-butylbenzoate,benzoic acid, p-tert-butyl-, methyl ester PubChem CID: 97433 IUPAC Name: methyl 4-tert-butylbenzoate SMILES: CC(C)(C)C1=CC=C(C=C1)C(=O)OC
| PubChem CID | 97433 |
|---|---|
| CAS | 26537-19-9 |
| Molecular Weight (g/mol) | 192.26 |
| MDL Number | MFCD00008835 |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(=O)OC |
| Synonym | methyl 4-tert-butyl benzoate,methyl p-tert-butylbenzoate,4-tert-butylbenzoic acid methyl ester,unii-8vk4o27jmt,benzoic acid, 4-1,1-dimethylethyl-, methyl ester,methyl 4-t-butylbenzoate,8vk4o27jmt,methyl4-tert-butylbenzoate,methyl p-t-butylbenzoate,benzoic acid, p-tert-butyl-, methyl ester |
| IUPAC Name | methyl 4-tert-butylbenzoate |
| InChI Key | UPIJOAFHOIWPLT-UHFFFAOYSA-N |
| Molecular Formula | C12H16O2 |
BHT, Granular, FCC, 99%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 128-37-0 Molecular Formula: C15H24O Molecular Weight (g/mol): 220.36 InChI Key: NLZUEZXRPGMBCV-UHFFFAOYSA-N IUPAC Name: 2,6-di-tert-butyl-4-methylphenol SMILES: CC1=CC(=C(O)C(=C1)C(C)(C)C)C(C)(C)C
| CAS | 128-37-0 |
|---|---|
| Molecular Weight (g/mol) | 220.36 |
| SMILES | CC1=CC(=C(O)C(=C1)C(C)(C)C)C(C)(C)C |
| IUPAC Name | 2,6-di-tert-butyl-4-methylphenol |
| InChI Key | NLZUEZXRPGMBCV-UHFFFAOYSA-N |
| Molecular Formula | C15H24O |
4-(2-Cyano-2-propyl)benzeneboronic acid, 97%, Thermo Scientific™
CAS: 850568-67-1 Molecular Formula: C10H12BNO2 Molecular Weight (g/mol): 189.021 MDL Number: MFCD06659832 InChI Key: BNXBFDTWYHAEIR-UHFFFAOYSA-N Synonym: 2-4-boronophenyl-2-methylpropanenitrile,4-2-cyanopropan-2-yl phenylboronic acid,4-1-cyano-1-methylethyl phenyl boronic acid,2-4-boronophenyl-2-methylpropionitrile,4-2-cyanopropan-2-yl benzeneboronic acid,4-2-cyanopropan-2-yl phenyl boronic acid,4-1-cyano-1-methylethyl phenylboronic acid,4-2-cyanoprop-2-yl benzeneboronic acid,boronic acid, 4-1-cyano-1-methylethyl phenyl PubChem CID: 44119324 IUPAC Name: [4-(2-cyanopropan-2-yl)phenyl]boronic acid SMILES: B(C1=CC=C(C=C1)C(C)(C)C#N)(O)O
| PubChem CID | 44119324 |
|---|---|
| CAS | 850568-67-1 |
| Molecular Weight (g/mol) | 189.021 |
| MDL Number | MFCD06659832 |
| SMILES | B(C1=CC=C(C=C1)C(C)(C)C#N)(O)O |
| Synonym | 2-4-boronophenyl-2-methylpropanenitrile,4-2-cyanopropan-2-yl phenylboronic acid,4-1-cyano-1-methylethyl phenyl boronic acid,2-4-boronophenyl-2-methylpropionitrile,4-2-cyanopropan-2-yl benzeneboronic acid,4-2-cyanopropan-2-yl phenyl boronic acid,4-1-cyano-1-methylethyl phenylboronic acid,4-2-cyanoprop-2-yl benzeneboronic acid,boronic acid, 4-1-cyano-1-methylethyl phenyl |
| IUPAC Name | [4-(2-cyanopropan-2-yl)phenyl]boronic acid |
| InChI Key | BNXBFDTWYHAEIR-UHFFFAOYSA-N |
| Molecular Formula | C10H12BNO2 |
4-tert-Butylbenzyl alcohol, 98%
CAS: 877-65-6 Molecular Formula: C11H16O Molecular Weight (g/mol): 164.248 MDL Number: MFCD00004662 InChI Key: FVEINXLJOJPHLH-UHFFFAOYSA-N Synonym: 4-tert-butylbenzyl alcohol,4-tert-butyl phenyl methanol,4-tert-butylphenyl methanol,4-t-butylbenzyl alcohol,p-tert-butylbenzyl alcohol,4-t-butylbenzylalcohol,benzenemethanol, 4-1,1-dimethylethyl,4-1,1-dimethylethyl benzenemethanol,4-tert-butylbenzylalcohol,p-t-butylbenzyl alcohol PubChem CID: 13416 IUPAC Name: (4-tert-butylphenyl)methanol SMILES: CC(C)(C)C1=CC=C(C=C1)CO
| PubChem CID | 13416 |
|---|---|
| CAS | 877-65-6 |
| Molecular Weight (g/mol) | 164.248 |
| MDL Number | MFCD00004662 |
| SMILES | CC(C)(C)C1=CC=C(C=C1)CO |
| Synonym | 4-tert-butylbenzyl alcohol,4-tert-butyl phenyl methanol,4-tert-butylphenyl methanol,4-t-butylbenzyl alcohol,p-tert-butylbenzyl alcohol,4-t-butylbenzylalcohol,benzenemethanol, 4-1,1-dimethylethyl,4-1,1-dimethylethyl benzenemethanol,4-tert-butylbenzylalcohol,p-t-butylbenzyl alcohol |
| IUPAC Name | (4-tert-butylphenyl)methanol |
| InChI Key | FVEINXLJOJPHLH-UHFFFAOYSA-N |
| Molecular Formula | C11H16O |
alpha-Isopropylphenylacetic acid, 97%
CAS: 3508-94-9 Molecular Formula: C11H14O2 Molecular Weight (g/mol): 178.231 MDL Number: MFCD00021708 InChI Key: HDLQGISFYDYWFJ-UHFFFAOYSA-N Synonym: alpha-isopropylphenylacetic acid,2-isopropyl-2-phenylacetic acid,3-methyl-2-phenyl-butyric acid,3-methyl-2-phenylbutyric acid,butyric acid, 3-methyl-2-phenyl,benzeneacetic acid, alpha-1-methylethyl,2-phenylisovaleric acid,acmc-1bn3m,benzeneacetic acid, alpha-1-methylethyl-9ci,alpha-isopropylphenylaceticacid PubChem CID: 19024 IUPAC Name: 3-methyl-2-phenylbutanoic acid SMILES: CC(C)C(C1=CC=CC=C1)C(=O)O
| PubChem CID | 19024 |
|---|---|
| CAS | 3508-94-9 |
| Molecular Weight (g/mol) | 178.231 |
| MDL Number | MFCD00021708 |
| SMILES | CC(C)C(C1=CC=CC=C1)C(=O)O |
| Synonym | alpha-isopropylphenylacetic acid,2-isopropyl-2-phenylacetic acid,3-methyl-2-phenyl-butyric acid,3-methyl-2-phenylbutyric acid,butyric acid, 3-methyl-2-phenyl,benzeneacetic acid, alpha-1-methylethyl,2-phenylisovaleric acid,acmc-1bn3m,benzeneacetic acid, alpha-1-methylethyl-9ci,alpha-isopropylphenylaceticacid |
| IUPAC Name | 3-methyl-2-phenylbutanoic acid |
| InChI Key | HDLQGISFYDYWFJ-UHFFFAOYSA-N |
| Molecular Formula | C11H14O2 |
4-tert-Butylphenol, 99%
CAS: 98-54-4 Molecular Formula: C10H14O MDL Number: MFCD00002367 InChI Key: QHPQWRBYOIRBIT-UHFFFAOYSA-N Synonym: 4-tert-butyl phenol,butylphen,p-tert-butylphenol,ptbp,4-1,1-dimethylethyl phenol,4-t-butylphenol,p-t-butyl phenol,phenol, 4-1,1-dimethylethyl,p-t-butylphenol,p-terc.butylfenol PubChem CID: 7393 ChEBI: CHEBI:34444 IUPAC Name: 4-tert-butylphenol
| PubChem CID | 7393 |
|---|---|
| CAS | 98-54-4 |
| ChEBI | CHEBI:34444 |
| MDL Number | MFCD00002367 |
| Synonym | 4-tert-butyl phenol,butylphen,p-tert-butylphenol,ptbp,4-1,1-dimethylethyl phenol,4-t-butylphenol,p-t-butyl phenol,phenol, 4-1,1-dimethylethyl,p-t-butylphenol,p-terc.butylfenol |
| IUPAC Name | 4-tert-butylphenol |
| InChI Key | QHPQWRBYOIRBIT-UHFFFAOYSA-N |
| Molecular Formula | C10H14O |
2,5-Di-tert-butylhydroquinone, 99%
CAS: 88-58-4 Molecular Formula: C14H22O2 Molecular Weight (g/mol): 222.33 MDL Number: MFCD00008825 InChI Key: JZODKRWQWUWGCD-UHFFFAOYSA-N Synonym: 2,5-di-tert-butylhydroquinone,2,5-di-tert-butylbenzene-1,4-diol,dibug,dtbhq,dybug,santovar o,di-t-butylhydroquinone,2,5-di-tert-butylquinol,nonflex alba,2,5-di-t-butylhydroquinone PubChem CID: 2374 ChEBI: CHEBI:41094 IUPAC Name: 2,5-ditert-butylbenzene-1,4-diol SMILES: CC(C)(C)C1=CC(O)=C(C=C1O)C(C)(C)C
| PubChem CID | 2374 |
|---|---|
| CAS | 88-58-4 |
| Molecular Weight (g/mol) | 222.33 |
| ChEBI | CHEBI:41094 |
| MDL Number | MFCD00008825 |
| SMILES | CC(C)(C)C1=CC(O)=C(C=C1O)C(C)(C)C |
| Synonym | 2,5-di-tert-butylhydroquinone,2,5-di-tert-butylbenzene-1,4-diol,dibug,dtbhq,dybug,santovar o,di-t-butylhydroquinone,2,5-di-tert-butylquinol,nonflex alba,2,5-di-t-butylhydroquinone |
| IUPAC Name | 2,5-ditert-butylbenzene-1,4-diol |
| InChI Key | JZODKRWQWUWGCD-UHFFFAOYSA-N |
| Molecular Formula | C14H22O2 |
Butylated Hydroxytoluene, Granular, NF, 99-101.5%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 128-37-0 Molecular Formula: C15H24O Molecular Weight (g/mol): 220.36 InChI Key: NLZUEZXRPGMBCV-UHFFFAOYSA-N IUPAC Name: 2,6-di-tert-butyl-4-methylphenol SMILES: CC1=CC(=C(O)C(=C1)C(C)(C)C)C(C)(C)C
| CAS | 128-37-0 |
|---|---|
| Molecular Weight (g/mol) | 220.36 |
| SMILES | CC1=CC(=C(O)C(=C1)C(C)(C)C)C(C)(C)C |
| IUPAC Name | 2,6-di-tert-butyl-4-methylphenol |
| InChI Key | NLZUEZXRPGMBCV-UHFFFAOYSA-N |
| Molecular Formula | C15H24O |
2-Fluorophenylacetone, 98%
CAS: 2836-82-0 Molecular Formula: C9H9FO Molecular Weight (g/mol): 152.168 MDL Number: MFCD00000325 InChI Key: BANVZEUCJHUPOI-UHFFFAOYSA-N Synonym: 2-fluorophenylacetone,1-2-fluorophenyl propan-2-one,1-2-fluorophenyl acetone,2-fluorophenyl acetone,o-fluorophenylacetone,2-propanone, 1-2-fluorophenyl,acmc-20anub,ksc497e4p,1-2-fluorophenyl acetone # PubChem CID: 76086 IUPAC Name: 1-(2-fluorophenyl)propan-2-one SMILES: CC(=O)CC1=CC=CC=C1F
| PubChem CID | 76086 |
|---|---|
| CAS | 2836-82-0 |
| Molecular Weight (g/mol) | 152.168 |
| MDL Number | MFCD00000325 |
| SMILES | CC(=O)CC1=CC=CC=C1F |
| Synonym | 2-fluorophenylacetone,1-2-fluorophenyl propan-2-one,1-2-fluorophenyl acetone,2-fluorophenyl acetone,o-fluorophenylacetone,2-propanone, 1-2-fluorophenyl,acmc-20anub,ksc497e4p,1-2-fluorophenyl acetone # |
| IUPAC Name | 1-(2-fluorophenyl)propan-2-one |
| InChI Key | BANVZEUCJHUPOI-UHFFFAOYSA-N |
| Molecular Formula | C9H9FO |